C24H32ClN5O2 — CID 118958752
tert-butyl N-[2-[2-[3-(4-chloro-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)phenyl]ethylamino]ethyl]carbamate (PubChem CID 118958752) has the molecular formula C24H32ClN5O2 and a molecular weight of 458.01 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[3-(4-chloro-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)phenyl]ethylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[3-(4-chloro-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)phenyl]ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 118958752 |
| Molecular Formula | C24H32ClN5O2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | tert-butyl N-[2-[2-[3-(4-chloro-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)phenyl]ethylamino]ethyl]carbamate |
| SMILES | CC(C)n1ncc2c(Cl)cc(-c3cccc(CCNCCNC(=O)OC(C)(C)C)c3)nc21 |
| InChI | InChI=1S/C24H32ClN5O2/c1-16(2)30-22-19(15-28-30)20(25)14-21(29-22)18-8-6-7-17(13-18)9-10-26-11-12-27-23(31)32-24(3,4)5/h6-8,13-16,26H,9-12H2,1-5H3,(H,27,31) |
| InChIKey | DIGCMNNOXAEMOJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|