C17H23N3O4 — CID 11427584
tert-butyl N-[[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]methyl]carbamate (PubChem CID 11427584) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is tert-butyl N-[[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 11427584 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | tert-butyl N-[[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]methyl]carbamate |
| SMILES | COCCn1c(CNC(=O)OC(C)(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C17H23N3O4/c1-17(2,3)24-16(22)18-11-14-19-13-8-6-5-7-12(13)15(21)20(14)9-10-23-4/h5-8H,9-11H2,1-4H3,(H,18,22) |
| InChIKey | DQZAEQWUGSFWCD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |