C22H27N3O3 — CID 143141149
tert-butyl N-[[3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-4-oxoquinazolin-2-yl]methyl]carbamate (PubChem CID 143141149) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is tert-butyl N-[[3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-4-oxoquinazolin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-4-oxoquinazolin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 143141149 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | tert-butyl N-[[3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-4-oxoquinazolin-2-yl]methyl]carbamate |
| SMILES | C/C=C\C=C(/C=C\C)n1c(CNC(=O)OC(C)(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H27N3O3/c1-6-8-12-16(11-7-2)25-19(15-23-21(27)28-22(3,4)5)24-18-14-10-9-13-17(18)20(25)26/h6-14H,15H2,1-5H3,(H,23,27)/b8-6-,11-7-,16-12+ |
| InChIKey | BOOCNCSDTSXBOG-SQMFFEPWSA-N |
| XLogP | 4.41 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|