C19H32ClN3O2 — CID 177189179
tert-butyl N-[4-[2-(chloromethyl)-5,6-dihydrobenzimidazol-1-yl]butyl]carbamate;ethane (PubChem CID 177189179) has the molecular formula C19H32ClN3O2 and a molecular weight of 369.94 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(chloromethyl)-5,6-dihydrobenzimidazol-1-yl]butyl]carbamate;ethane.
| Compound Name | tert-butyl N-[4-[2-(chloromethyl)-5,6-dihydrobenzimidazol-1-yl]butyl]carbamate;ethane |
|---|---|
| PubChem CID | 177189179 |
| Molecular Formula | C19H32ClN3O2 |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | tert-butyl N-[4-[2-(chloromethyl)-5,6-dihydrobenzimidazol-1-yl]butyl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NCCCCn1c(CCl)nc2c1=CCCC=2 |
| InChI | InChI=1S/C17H26ClN3O2.C2H6/c1-17(2,3)23-16(22)19-10-6-7-11-21-14-9-5-4-8-13(14)20-15(21)12-18;1-2/h8-9H,4-7,10-12H2,1-3H3,(H,19,22);1-2H3 |
| InChIKey | OFQIMNPTHPSRSB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|