C24H19N3O4 — CID 71600958
methyl 6-(3-imidazol-1-ylpropyl)-5,11-dioxoindeno[1,2-c]isoquinoline-3-carboxylate (PubChem CID 71600958) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is methyl 6-(3-imidazol-1-ylpropyl)-5,11-dioxoindeno[1,2-c]isoquinoline-3-carboxylate.
| Compound Name | methyl 6-(3-imidazol-1-ylpropyl)-5,11-dioxoindeno[1,2-c]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 71600958 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | methyl 6-(3-imidazol-1-ylpropyl)-5,11-dioxoindeno[1,2-c]isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1ccc2c3c(n(CCCn4ccnc4)c(=O)c2c1)-c1ccccc1C3=O |
| InChI | InChI=1S/C24H19N3O4/c1-31-24(30)15-7-8-16-19(13-15)23(29)27(11-4-10-26-12-9-25-14-26)21-17-5-2-3-6-18(17)22(28)20(16)21/h2-3,5-9,12-14H,4,10-11H2,1H3 |
| InChIKey | CZWJZYWUPMHZKI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|