C17H18ClN3O2 — CID 10853996
methyl 1-(3-chloropropyl)-3-(imidazol-1-ylmethyl)indole-6-carboxylate (PubChem CID 10853996) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is methyl 1-(3-chloropropyl)-3-(imidazol-1-ylmethyl)indole-6-carboxylate.
| Compound Name | methyl 1-(3-chloropropyl)-3-(imidazol-1-ylmethyl)indole-6-carboxylate |
|---|---|
| PubChem CID | 10853996 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | methyl 1-(3-chloropropyl)-3-(imidazol-1-ylmethyl)indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(Cn3ccnc3)cn(CCCCl)c2c1 |
| InChI | InChI=1S/C17H18ClN3O2/c1-23-17(22)13-3-4-15-14(10-20-8-6-19-12-20)11-21(7-2-5-18)16(15)9-13/h3-4,6,8-9,11-12H,2,5,7,10H2,1H3 |
| InChIKey | UOMSGLHRTOEYKF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|