C27H24N4O6 — CID 23456724
(E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione (PubChem CID 23456724) has the molecular formula C27H24N4O6 and a molecular weight of 500.51 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23456724 |
| Molecular Formula | C27H24N4O6 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C(O)/C=C/C(=O)O.O=C1c2ccccc2C(=O)N1CCCn1cc(Cn2ccnc2)c2ccccc21 |
| InChI | InChI=1S/C23H20N4O2.C4H4O4/c28-22-19-7-1-2-8-20(19)23(29)27(22)12-5-11-26-15-17(14-25-13-10-24-16-25)18-6-3-4-9-21(18)26;5-3(6)1-2-4(7)8/h1-4,6-10,13,15-16H,5,11-12,14H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | YBECDFADTXWKRW-WLHGVMLRSA-N |
| XLogP | 3.28 |
| TPSA | 134.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|