About (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione
(E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione (PubChem CID 23456724) has the molecular formula C27H24N4O6
and a molecular weight of 500.51 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione |
| PubChem CID | 23456724 |
| Molecular Formula | C27H24N4O6 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C(O)/C=C/C(=O)O.O=C1c2ccccc2C(=O)N1CCCn1cc(Cn2ccnc2)c2ccccc21 |
| InChI | InChI=1S/C23H20N4O2.C4H4O4/c28-22-19-7-1-2-8-20(19)23(29)27(22)12-5-11-26-15-17(14-25-13-10-24-16-25)18-6-3-4-9-21(18)26;5-3(6)1-2-4(7)8/h1-4,6-10,13,15-16H,5,11-12,14H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | YBECDFADTXWKRW-WLHGVMLRSA-N |
| XLogP | 3.28 |
| TPSA | 134.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione?
The IUPAC name of (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione (CID 23456724) is (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione.
What is the SMILES notation for (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione?
The canonical SMILES for (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione is O=C(O)/C=C/C(=O)O.O=C1c2ccccc2C(=O)N1CCCn1cc(Cn2ccnc2)c2ccccc21.
What is the InChIKey of (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione?
The InChIKey is YBECDFADTXWKRW-WLHGVMLRSA-N. The full InChI is InChI=1S/C23H20N4O2.C4H4O4/c28-22-19-7-1-2-8-20(19)23(29)27(22)12-5-11-26-15-17(14-25-13-10-24-16-25)18-6-3-4-9-21(18)26;5-3(6)1-2-4(7)8/h1-4,6-10,13,15-16H,5,11-12,14H2;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione?
(E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione has a molecular weight of 500.51 g/mol, XLogP of 3.28, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;2-[3-[3-(imidazol-1-ylmethyl)indol-1-yl]propyl]isoindole-1,3-dione is sourced from PubChem (CID 23456724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).