C27H27N3O7 — CID 71546349
methyl 2-[[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5,11-dioxoindeno[1,2-c]isoquinolin-3-yl]amino]-2-oxoacetate (PubChem CID 71546349) has the molecular formula C27H27N3O7 and a molecular weight of 505.53 g/mol. Its IUPAC name is methyl 2-[[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5,11-dioxoindeno[1,2-c]isoquinolin-3-yl]amino]-2-oxoacetate.
| Compound Name | methyl 2-[[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5,11-dioxoindeno[1,2-c]isoquinolin-3-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 71546349 |
| Molecular Formula | C27H27N3O7 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | methyl 2-[[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5,11-dioxoindeno[1,2-c]isoquinolin-3-yl]amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ccc2c3c(n(CCCNC(=O)OC(C)(C)C)c(=O)c2c1)-c1ccccc1C3=O |
| InChI | InChI=1S/C27H27N3O7/c1-27(2,3)37-26(35)28-12-7-13-30-21-17-8-5-6-9-18(17)22(31)20(21)16-11-10-15(14-19(16)24(30)33)29-23(32)25(34)36-4/h5-6,8-11,14H,7,12-13H2,1-4H3,(H,28,35)(H,29,32) |
| InChIKey | UCQGOENNPRXALX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|