C26H25ClF5N5O2 — CID 171067881
7-chloro-N-[2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-6-pyridin-4-yl-1H-indazol-4-amine (PubChem CID 171067881) has the molecular formula C26H25ClF5N5O2 and a molecular weight of 569.96 g/mol. Its IUPAC name is 7-chloro-N-[2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-6-pyridin-4-yl-1H-indazol-4-amine.
| Compound Name | 7-chloro-N-[2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-6-pyridin-4-yl-1H-indazol-4-amine |
|---|---|
| PubChem CID | 171067881 |
| Molecular Formula | C26H25ClF5N5O2 |
| Molecular Weight | 569.96 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | 7-chloro-N-[2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-6-pyridin-4-yl-1H-indazol-4-amine |
| SMILES | Fc1cc(CNCCCCOCCNc2cc(-c3ccncc3)c(Cl)c3[nH]ncc23)cc(F)c1OC(F)(F)F |
| InChI | InChI=1S/C26H25ClF5N5O2/c27-23-18(17-3-6-33-7-4-17)13-22(19-15-36-37-24(19)23)35-8-10-38-9-2-1-5-34-14-16-11-20(28)25(21(29)12-16)39-26(30,31)32/h3-4,6-7,11-13,15,34-35H,1-2,5,8-10,14H2,(H,36,37) |
| InChIKey | XSYIEFQAXLMOLH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.96 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|