C24H27F3N6O3S — CID 171067064
N-[2-[4-[[3-methoxy-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-6-(thiadiazol-5-yl)-1H-indazol-4-amine (PubChem CID 171067064) has the molecular formula C24H27F3N6O3S and a molecular weight of 536.58 g/mol. Its IUPAC name is N-[2-[4-[[3-methoxy-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-6-(thiadiazol-5-yl)-1H-indazol-4-amine.
| Compound Name | N-[2-[4-[[3-methoxy-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-6-(thiadiazol-5-yl)-1H-indazol-4-amine |
|---|---|
| PubChem CID | 171067064 |
| Molecular Formula | C24H27F3N6O3S |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | N-[2-[4-[[3-methoxy-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-6-(thiadiazol-5-yl)-1H-indazol-4-amine |
| SMILES | COc1cc(CNCCCCOCCNc2cc(-c3cnns3)cc3[nH]ncc23)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C24H27F3N6O3S/c1-34-18-8-16(9-19(12-18)36-24(25,26)27)13-28-4-2-3-6-35-7-5-29-21-10-17(23-15-31-33-37-23)11-22-20(21)14-30-32-22/h8-12,14-15,28-29H,2-7,13H2,1H3,(H,30,32) |
| InChIKey | XKOABTPWRBGZSC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|