C25H28F3N5O4S — CID 171066791
2-[3-[[4-[2-[[6-(thiadiazol-5-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)phenyl]ethanol (PubChem CID 171066791) has the molecular formula C25H28F3N5O4S and a molecular weight of 551.59 g/mol. Its IUPAC name is 2-[3-[[4-[2-[[6-(thiadiazol-5-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | 2-[3-[[4-[2-[[6-(thiadiazol-5-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 171066791 |
| Molecular Formula | C25H28F3N5O4S |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 2-[3-[[4-[2-[[6-(thiadiazol-5-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)phenyl]ethanol |
| SMILES | OCCc1cc(CNCCCCOCCOc2cc(-c3cnns3)cc3[nH]ncc23)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C25H28F3N5O4S/c26-25(27,28)37-20-10-17(3-5-34)9-18(11-20)14-29-4-1-2-6-35-7-8-36-23-13-19(24-16-31-33-38-24)12-22-21(23)15-30-32-22/h9-13,15-16,29,34H,1-8,14H2,(H,30,32) |
| InChIKey | DIWYRXYPEOTSGF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|