C26H26F3N7O4 — CID 171067044
3-[[4-[2-[[6-(5-cyano-1H-pyrazol-4-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)benzamide (PubChem CID 171067044) has the molecular formula C26H26F3N7O4 and a molecular weight of 557.53 g/mol. Its IUPAC name is 3-[[4-[2-[[6-(5-cyano-1H-pyrazol-4-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)benzamide.
| Compound Name | 3-[[4-[2-[[6-(5-cyano-1H-pyrazol-4-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 171067044 |
| Molecular Formula | C26H26F3N7O4 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 3-[[4-[2-[[6-(5-cyano-1H-pyrazol-4-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)benzamide |
| SMILES | N#Cc1[nH]ncc1-c1cc(OCCOCCCCNCc2cc(OC(F)(F)F)cc(C(N)=O)c2)c2cn[nH]c2c1 |
| InChI | InChI=1S/C26H26F3N7O4/c27-26(28,29)40-19-8-16(7-18(9-19)25(31)37)13-32-3-1-2-4-38-5-6-39-24-11-17(10-22-21(24)15-34-35-22)20-14-33-36-23(20)12-30/h7-11,14-15,32H,1-6,13H2,(H2,31,37)(H,33,36)(H,34,35) |
| InChIKey | GONTWONVVCQFIW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|