C25H27F3N4O4 — CID 171066712
[3-[[4-[2-[[6-(1,2-oxazol-4-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethyl)phenyl]methanol (PubChem CID 171066712) has the molecular formula C25H27F3N4O4 and a molecular weight of 504.51 g/mol. Its IUPAC name is [3-[[4-[2-[[6-(1,2-oxazol-4-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethyl)phenyl]methanol.
| Compound Name | [3-[[4-[2-[[6-(1,2-oxazol-4-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 171066712 |
| Molecular Formula | C25H27F3N4O4 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | [3-[[4-[2-[[6-(1,2-oxazol-4-yl)-1H-indazol-4-yl]oxy]ethoxy]butylamino]methyl]-5-(trifluoromethyl)phenyl]methanol |
| SMILES | OCc1cc(CNCCCCOCCOc2cc(-c3cnoc3)cc3[nH]ncc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H27F3N4O4/c26-25(27,28)21-8-17(7-18(9-21)15-33)12-29-3-1-2-4-34-5-6-35-24-11-19(20-13-31-36-16-20)10-23-22(24)14-30-32-23/h7-11,13-14,16,29,33H,1-6,12,15H2,(H,30,32) |
| InChIKey | AHUINIMKZPEWGA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 105.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|