C26H28F3N5O3 — CID 171067642
[3-[[4-[1-[6-(1,2-oxazol-4-yl)-1H-indazol-4-yl]azetidin-3-yl]oxybutylamino]methyl]-5-(trifluoromethyl)phenyl]methanol (PubChem CID 171067642) has the molecular formula C26H28F3N5O3 and a molecular weight of 515.54 g/mol. Its IUPAC name is [3-[[4-[1-[6-(1,2-oxazol-4-yl)-1H-indazol-4-yl]azetidin-3-yl]oxybutylamino]methyl]-5-(trifluoromethyl)phenyl]methanol.
| Compound Name | [3-[[4-[1-[6-(1,2-oxazol-4-yl)-1H-indazol-4-yl]azetidin-3-yl]oxybutylamino]methyl]-5-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 171067642 |
| Molecular Formula | C26H28F3N5O3 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | [3-[[4-[1-[6-(1,2-oxazol-4-yl)-1H-indazol-4-yl]azetidin-3-yl]oxybutylamino]methyl]-5-(trifluoromethyl)phenyl]methanol |
| SMILES | OCc1cc(CNCCCCOC2CN(c3cc(-c4cnoc4)cc4[nH]ncc34)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H28F3N5O3/c27-26(28,29)21-6-17(5-18(7-21)15-35)10-30-3-1-2-4-36-22-13-34(14-22)25-9-19(20-11-32-37-16-20)8-24-23(25)12-31-33-24/h5-9,11-12,16,22,30,35H,1-4,10,13-15H2,(H,31,33) |
| InChIKey | MFCXXSAVZZKQAY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|