C16H23N7O — CID 171067957
N-[4-[3-(4-aminobutoxy)azetidin-1-yl]-1H-indazol-6-yl]-N-methanimidoylmethanimidamide (PubChem CID 171067957) has the molecular formula C16H23N7O and a molecular weight of 329.41 g/mol. Its IUPAC name is N-[4-[3-(4-aminobutoxy)azetidin-1-yl]-1H-indazol-6-yl]-N-methanimidoylmethanimidamide.
| Compound Name | N-[4-[3-(4-aminobutoxy)azetidin-1-yl]-1H-indazol-6-yl]-N-methanimidoylmethanimidamide |
|---|---|
| PubChem CID | 171067957 |
| Molecular Formula | C16H23N7O |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-[4-[3-(4-aminobutoxy)azetidin-1-yl]-1H-indazol-6-yl]-N-methanimidoylmethanimidamide |
| SMILES | [H]/N=C/N(/C=N/[H])c1cc(N2CC(OCCCCN)C2)c2cn[nH]c2c1 |
| InChI | InChI=1S/C16H23N7O/c17-3-1-2-4-24-13-8-22(9-13)16-6-12(23(10-18)11-19)5-15-14(16)7-20-21-15/h5-7,10-11,13,18-19H,1-4,8-9,17H2,(H,20,21)/b18-10+,19-11+ |
| InChIKey | ICSRNJKKLKHZMR-XOBNHNQQSA-N |
| XLogP | 1.53 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|