C24H28FN7O2 — CID 171067793
[3-fluoro-5-[[4-[1-[6-(1,2,4-triazol-4-yl)-1H-indazol-4-yl]azetidin-3-yl]oxybutylamino]methyl]phenyl]methanol (PubChem CID 171067793) has the molecular formula C24H28FN7O2 and a molecular weight of 465.53 g/mol. Its IUPAC name is [3-fluoro-5-[[4-[1-[6-(1,2,4-triazol-4-yl)-1H-indazol-4-yl]azetidin-3-yl]oxybutylamino]methyl]phenyl]methanol.
| Compound Name | [3-fluoro-5-[[4-[1-[6-(1,2,4-triazol-4-yl)-1H-indazol-4-yl]azetidin-3-yl]oxybutylamino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 171067793 |
| Molecular Formula | C24H28FN7O2 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | [3-fluoro-5-[[4-[1-[6-(1,2,4-triazol-4-yl)-1H-indazol-4-yl]azetidin-3-yl]oxybutylamino]methyl]phenyl]methanol |
| SMILES | OCc1cc(F)cc(CNCCCCOC2CN(c3cc(-n4cnnc4)cc4[nH]ncc34)C2)c1 |
| InChI | InChI=1S/C24H28FN7O2/c25-19-6-17(5-18(7-19)14-33)10-26-3-1-2-4-34-21-12-31(13-21)24-9-20(32-15-28-29-16-32)8-23-22(24)11-27-30-23/h5-9,11,15-16,21,26,33H,1-4,10,12-14H2,(H,27,30) |
| InChIKey | ZTADWSAYUDBTAR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|