C12H25NO6 — CID 57203163
(1S,2S,4S,5R)-6-(6-aminohexoxy)cyclohexane-1,2,3,4,5-pentol (PubChem CID 57203163) has the molecular formula C12H25NO6 and a molecular weight of 279.33 g/mol. Its IUPAC name is (1S,2S,4S,5R)-6-(6-aminohexoxy)cyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1S,2S,4S,5R)-6-(6-aminohexoxy)cyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 57203163 |
| Molecular Formula | C12H25NO6 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (1S,2S,4S,5R)-6-(6-aminohexoxy)cyclohexane-1,2,3,4,5-pentol |
| SMILES | NCCCCCCOC1[C@@H](O)[C@@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H25NO6/c13-5-3-1-2-4-6-19-12-10(17)8(15)7(14)9(16)11(12)18/h7-12,14-18H,1-6,13H2/t7?,8-,9-,10-,11+,12?/m0/s1 |
| InChIKey | AVQLNKDLUYNZAN-KTUNPDJDSA-N |
| XLogP | -2.29 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|