C18H39N5O6 — CID 3013634
(1S,2R,3R,4S,6R)-4,6-diamino-3-[(2R,3R,4R,5S,6R)-3-amino-5-(6-aminohexoxy)-6-(aminomethyl)-4-hydroxyoxan-2-yl]oxycyclohexane-1,2-diol (PubChem CID 3013634) has the molecular formula C18H39N5O6 and a molecular weight of 421.54 g/mol. Its IUPAC name is (1S,2R,3R,4S,6R)-4,6-diamino-3-[(2R,3R,4R,5S,6R)-3-amino-5-(6-aminohexoxy)-6-(aminomethyl)-4-hydroxyoxan-2-yl]oxycyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4S,6R)-4,6-diamino-3-[(2R,3R,4R,5S,6R)-3-amino-5-(6-aminohexoxy)-6-(aminomethyl)-4-hydroxyoxan-2-yl]oxycyclohexane-1,2-diol |
|---|---|
| PubChem CID | 3013634 |
| Molecular Formula | C18H39N5O6 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | (1S,2R,3R,4S,6R)-4,6-diamino-3-[(2R,3R,4R,5S,6R)-3-amino-5-(6-aminohexoxy)-6-(aminomethyl)-4-hydroxyoxan-2-yl]oxycyclohexane-1,2-diol |
| SMILES | NCCCCCCO[C@H]1[C@H](O)[C@@H](N)[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N)C[C@@H]2N)O[C@@H]1CN |
| InChI | InChI=1S/C18H39N5O6/c19-5-3-1-2-4-6-27-17-11(8-20)28-18(12(23)14(17)25)29-16-10(22)7-9(21)13(24)15(16)26/h9-18,24-26H,1-8,19-23H2/t9-,10+,11-,12-,13+,14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | LBHPNBNAVYZRTA-IKKGWKPSSA-N |
| XLogP | -3.57 |
| TPSA | 218.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|