C20H42N4O6 — CID 72704508
(2R,3R,4R,5R,6R)-5-amino-2-(aminomethyl)-4-butoxy-6-[(1R,2R,3S,4R,6S)-4,6-diamino-3-butoxy-2-hydroxycyclohexyl]oxyoxan-3-ol (PubChem CID 72704508) has the molecular formula C20H42N4O6 and a molecular weight of 434.58 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-5-amino-2-(aminomethyl)-4-butoxy-6-[(1R,2R,3S,4R,6S)-4,6-diamino-3-butoxy-2-hydroxycyclohexyl]oxyoxan-3-ol.
| Compound Name | (2R,3R,4R,5R,6R)-5-amino-2-(aminomethyl)-4-butoxy-6-[(1R,2R,3S,4R,6S)-4,6-diamino-3-butoxy-2-hydroxycyclohexyl]oxyoxan-3-ol |
|---|---|
| PubChem CID | 72704508 |
| Molecular Formula | C20H42N4O6 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | (2R,3R,4R,5R,6R)-5-amino-2-(aminomethyl)-4-butoxy-6-[(1R,2R,3S,4R,6S)-4,6-diamino-3-butoxy-2-hydroxycyclohexyl]oxyoxan-3-ol |
| SMILES | CCCCO[C@@H]1[C@@H](N)[C@@H](O[C@H]2[C@H](O)[C@@H](OCCCC)[C@H](N)C[C@@H]2N)O[C@H](CN)[C@H]1O |
| InChI | InChI=1S/C20H42N4O6/c1-3-5-7-27-17-11(22)9-12(23)18(16(17)26)30-20-14(24)19(28-8-6-4-2)15(25)13(10-21)29-20/h11-20,25-26H,3-10,21-24H2,1-2H3/t11-,12+,13-,14-,15-,16-,17+,18-,19-,20-/m1/s1 |
| InChIKey | UUOFIFMKFQZEPS-OQYDGGSOSA-N |
| XLogP | -1.47 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|