C12H26CuN4O6+2 — CID 10178178
copper (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1S,2S,3R,4S,6R)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol (PubChem CID 10178178) has the molecular formula C12H26CuN4O6+2 and a molecular weight of 385.91 g/mol. Its IUPAC name is copper (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1S,2S,3R,4S,6R)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol.
| Compound Name | copper (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1S,2S,3R,4S,6R)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 10178178 |
| Molecular Formula | C12H26CuN4O6+2 |
| Molecular Weight | 385.91 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | copper (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1S,2S,3R,4S,6R)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol |
| SMILES | NC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](N)C[C@H]2N)[C@H](N)[C@@H](O)[C@@H]1O.[Cu+2] |
| InChI | InChI=1S/C12H26N4O6.Cu/c13-2-5-8(18)9(19)6(16)12(21-5)22-11-4(15)1-3(14)7(17)10(11)20;/h3-12,17-20H,1-2,13-16H2;/q;+2/t3-,4+,5+,6+,7+,8+,9+,10-,11-,12+;/m0./s1 |
| InChIKey | SUOIMMIMBOHCIP-PPHHLZIQSA-N |
| XLogP | -5.12 |
| TPSA | 203.46 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.91 |
| LogP ≤ 5 | -5.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |