C14H27F3N4O8 — CID 70634841
(2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol;2,2,2-trifluoroacetic acid (PubChem CID 70634841) has the molecular formula C14H27F3N4O8 and a molecular weight of 436.38 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70634841 |
| Molecular Formula | C14H27F3N4O8 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol;2,2,2-trifluoroacetic acid |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N)C[C@@H]2N)[C@H](N)[C@@H](O)[C@@H]1O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H26N4O6.C2HF3O2/c13-2-5-8(18)9(19)6(16)12(21-5)22-11-4(15)1-3(14)7(17)10(11)20;3-2(4,5)1(6)7/h3-12,17-20H,1-2,13-16H2;(H,6,7)/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-;/m1./s1 |
| InChIKey | JIUVGSFKKQXVNB-SQAHNGQVSA-N |
| XLogP | -4.48 |
| TPSA | 240.76 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | -4.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |