C28H58N4O8 — CID 123133527
(2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol;hexadecanoic acid (PubChem CID 123133527) has the molecular formula C28H58N4O8 and a molecular weight of 578.79 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol;hexadecanoic acid.
| Compound Name | (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol;hexadecanoic acid |
|---|---|
| PubChem CID | 123133527 |
| Molecular Formula | C28H58N4O8 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.43 |
| IUPAC Name | (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol;hexadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N)C[C@@H]2N)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H32O2.C12H26N4O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;13-2-5-8(18)9(19)6(16)12(21-5)22-11-4(15)1-3(14)7(17)10(11)20/h2-15H2,1H3,(H,17,18);3-12,17-20H,1-2,13-16H2/t;3-,4+,5-,6-,7+,8-,9-,10-,11-,12-/m.1/s1 |
| InChIKey | XBJFIVWYEHFNML-SJHBPNDZSA-N |
| XLogP | 0.44 |
| TPSA | 240.76 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|