C27H27F3N6O3 — CID 171067160
2-[3-[[4-[2-[(6-pyridazin-4-yl-1H-indazol-4-yl)oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)phenyl]acetonitrile (PubChem CID 171067160) has the molecular formula C27H27F3N6O3 and a molecular weight of 540.55 g/mol. Its IUPAC name is 2-[3-[[4-[2-[(6-pyridazin-4-yl-1H-indazol-4-yl)oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)phenyl]acetonitrile.
| Compound Name | 2-[3-[[4-[2-[(6-pyridazin-4-yl-1H-indazol-4-yl)oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 171067160 |
| Molecular Formula | C27H27F3N6O3 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 2-[3-[[4-[2-[(6-pyridazin-4-yl-1H-indazol-4-yl)oxy]ethoxy]butylamino]methyl]-5-(trifluoromethoxy)phenyl]acetonitrile |
| SMILES | N#CCc1cc(CNCCCCOCCOc2cc(-c3ccnnc3)cc3[nH]ncc23)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C27H27F3N6O3/c28-27(29,30)39-23-12-19(3-5-31)11-20(13-23)16-32-6-1-2-8-37-9-10-38-26-15-22(21-4-7-33-34-17-21)14-25-24(26)18-35-36-25/h4,7,11-15,17-18,32H,1-3,6,8-10,16H2,(H,35,36) |
| InChIKey | VFSHBZZZVCEIFZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|