C29H31ClN4O3 — CID 164915163
5-[2-[4-[(3-chloro-4-cyclopropylphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164915163) has the molecular formula C29H31ClN4O3 and a molecular weight of 519.05 g/mol. Its IUPAC name is 5-[2-[4-[(3-chloro-4-cyclopropylphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[2-[4-[(3-chloro-4-cyclopropylphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164915163 |
| Molecular Formula | C29H31ClN4O3 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 5-[2-[4-[(3-chloro-4-cyclopropylphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(NCCOCCCCNCc1ccc(C3CC3)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C29H31ClN4O3/c30-26-15-19(3-7-22(26)20-4-5-20)17-31-10-1-2-13-37-14-12-33-28-24-9-11-32-18-25(24)23-8-6-21(29(35)36)16-27(23)34-28/h3,6-9,11,15-16,18,20,31H,1-2,4-5,10,12-14,17H2,(H,33,34)(H,35,36) |
| InChIKey | PEVDNKUCOHNRTA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|