C30H31ClN8O — CID 171065994
5-[2-[4-[(3-chloro-4-pyrazin-2-ylphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171065994) has the molecular formula C30H31ClN8O and a molecular weight of 555.09 g/mol. Its IUPAC name is 5-[2-[4-[(3-chloro-4-pyrazin-2-ylphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[(3-chloro-4-pyrazin-2-ylphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171065994 |
| Molecular Formula | C30H31ClN8O |
| Molecular Weight | 555.09 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 5-[2-[4-[(3-chloro-4-pyrazin-2-ylphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCNCCCCNCc1ccc(-c3cnccn3)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C30H31ClN8O/c31-26-15-20(3-5-24(26)28-19-36-12-13-37-28)17-34-9-2-1-8-33-11-14-38-30-23-7-10-35-18-25(23)22-6-4-21(29(32)40)16-27(22)39-30/h3-7,10,12-13,15-16,18-19,33-34H,1-2,8-9,11,14,17H2,(H2,32,40)(H,38,39) |
| InChIKey | KSPHLQJHNXWQFY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 130.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.09 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|