C33H33ClN6O — CID 171066442
5-[2-[[3-[(3-chloro-4-phenylphenyl)methylamino]cyclobutyl]methylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066442) has the molecular formula C33H33ClN6O and a molecular weight of 565.12 g/mol. Its IUPAC name is 5-[2-[[3-[(3-chloro-4-phenylphenyl)methylamino]cyclobutyl]methylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[[3-[(3-chloro-4-phenylphenyl)methylamino]cyclobutyl]methylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066442 |
| Molecular Formula | C33H33ClN6O |
| Molecular Weight | 565.12 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 5-[2-[[3-[(3-chloro-4-phenylphenyl)methylamino]cyclobutyl]methylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCNCC1CC(NCc3ccc(-c4ccccc4)c(Cl)c3)C1)c1ccncc12 |
| InChI | InChI=1S/C33H33ClN6O/c34-30-16-21(6-8-26(30)23-4-2-1-3-5-23)19-39-25-14-22(15-25)18-37-12-13-38-33-28-10-11-36-20-29(28)27-9-7-24(32(35)41)17-31(27)40-33/h1-11,16-17,20,22,25,37,39H,12-15,18-19H2,(H2,35,41)(H,38,40) |
| InChIKey | WAVGOWCPFNTJAS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.12 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|