C31H35N7O2 — CID 171066289
5-[2-[4-[(3-cyano-4-cyclobutyloxyphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066289) has the molecular formula C31H35N7O2 and a molecular weight of 537.67 g/mol. Its IUPAC name is 5-[2-[4-[(3-cyano-4-cyclobutyloxyphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[(3-cyano-4-cyclobutyloxyphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066289 |
| Molecular Formula | C31H35N7O2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | 5-[2-[4-[(3-cyano-4-cyclobutyloxyphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | N#Cc1cc(CNCCCCNCCNc2nc3cc(C(N)=O)ccc3c3cnccc23)ccc1OC1CCC1 |
| InChI | InChI=1S/C31H35N7O2/c32-18-23-16-21(6-9-29(23)40-24-4-3-5-24)19-35-12-2-1-11-34-14-15-37-31-26-10-13-36-20-27(26)25-8-7-22(30(33)39)17-28(25)38-31/h6-10,13,16-17,20,24,34-35H,1-5,11-12,14-15,19H2,(H2,33,39)(H,37,38) |
| InChIKey | FKUMQIQPVBDFEZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|