C19H22N8O — CID 171065909
N-[2-(4-aminobutoxy)ethyl]-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine (PubChem CID 171065909) has the molecular formula C19H22N8O and a molecular weight of 378.44 g/mol. Its IUPAC name is N-[2-(4-aminobutoxy)ethyl]-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine.
| Compound Name | N-[2-(4-aminobutoxy)ethyl]-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine |
|---|---|
| PubChem CID | 171065909 |
| Molecular Formula | C19H22N8O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-[2-(4-aminobutoxy)ethyl]-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine |
| SMILES | NCCCCOCCNc1nc2cc(-c3nn[nH]n3)ccc2c2cnccc12 |
| InChI | InChI=1S/C19H22N8O/c20-6-1-2-9-28-10-8-22-19-15-5-7-21-12-16(15)14-4-3-13(11-17(14)23-19)18-24-26-27-25-18/h3-5,7,11-12H,1-2,6,8-10,20H2,(H,22,23)(H,24,25,26,27) |
| InChIKey | XBCSIEXOTHLURS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 127.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|