C30H33N7OS — CID 171066075
5-[2-[methyl-[4-[(5-phenyl-1,3-thiazol-2-yl)methylamino]butyl]amino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066075) has the molecular formula C30H33N7OS and a molecular weight of 539.71 g/mol. Its IUPAC name is 5-[2-[methyl-[4-[(5-phenyl-1,3-thiazol-2-yl)methylamino]butyl]amino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[methyl-[4-[(5-phenyl-1,3-thiazol-2-yl)methylamino]butyl]amino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066075 |
| Molecular Formula | C30H33N7OS |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 5-[2-[methyl-[4-[(5-phenyl-1,3-thiazol-2-yl)methylamino]butyl]amino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | CN(CCCCNCc1ncc(-c2ccccc2)s1)CCNc1nc2cc(C(N)=O)ccc2c2cnccc12 |
| InChI | InChI=1S/C30H33N7OS/c1-37(15-6-5-12-32-20-28-35-19-27(39-28)21-7-3-2-4-8-21)16-14-34-30-24-11-13-33-18-25(24)23-10-9-22(29(31)38)17-26(23)36-30/h2-4,7-11,13,17-19,32H,5-6,12,14-16,20H2,1H3,(H2,31,38)(H,34,36) |
| InChIKey | AFSPXWIAOKQFQH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|