C19H16N6OS — CID 77014395
4-[[3-(1,3-thiazol-2-ylamino)phenyl]methylamino]quinazoline-8-carboxamide (PubChem CID 77014395) has the molecular formula C19H16N6OS and a molecular weight of 376.45 g/mol. Its IUPAC name is 4-[[3-(1,3-thiazol-2-ylamino)phenyl]methylamino]quinazoline-8-carboxamide.
| Compound Name | 4-[[3-(1,3-thiazol-2-ylamino)phenyl]methylamino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 77014395 |
| Molecular Formula | C19H16N6OS |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-[[3-(1,3-thiazol-2-ylamino)phenyl]methylamino]quinazoline-8-carboxamide |
| SMILES | NC(=O)c1cccc2c(NCc3cccc(Nc4nccs4)c3)ncnc12 |
| InChI | InChI=1S/C19H16N6OS/c20-17(26)14-5-2-6-15-16(14)23-11-24-18(15)22-10-12-3-1-4-13(9-12)25-19-21-7-8-27-19/h1-9,11H,10H2,(H2,20,26)(H,21,25)(H,22,23,24) |
| InChIKey | PJXUDKNHESNHGD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |