C18H28BrNO4 — CID 126677137
tert-butyl N-[(4-bromophenyl)methyl]-N-[2-hydroxy-2-(2-methylpropoxy)ethyl]carbamate (PubChem CID 126677137) has the molecular formula C18H28BrNO4 and a molecular weight of 402.33 g/mol. Its IUPAC name is tert-butyl N-[(4-bromophenyl)methyl]-N-[2-hydroxy-2-(2-methylpropoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[(4-bromophenyl)methyl]-N-[2-hydroxy-2-(2-methylpropoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 126677137 |
| Molecular Formula | C18H28BrNO4 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | tert-butyl N-[(4-bromophenyl)methyl]-N-[2-hydroxy-2-(2-methylpropoxy)ethyl]carbamate |
| SMILES | CC(C)COC(O)CN(Cc1ccc(Br)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28BrNO4/c1-13(2)12-23-16(21)11-20(17(22)24-18(3,4)5)10-14-6-8-15(19)9-7-14/h6-9,13,16,21H,10-12H2,1-5H3 |
| InChIKey | DAUPGHXOBISLOJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|