C17H17Cl2FN4O3 — CID 130448052
[4-[(2-amino-6-fluoro-3-pyridinyl)amino]-4-oxobutyl] N-[(3,5-dichlorophenyl)methyl]carbamate (PubChem CID 130448052) has the molecular formula C17H17Cl2FN4O3 and a molecular weight of 415.25 g/mol. Its IUPAC name is [4-[(2-amino-6-fluoro-3-pyridinyl)amino]-4-oxobutyl] N-[(3,5-dichlorophenyl)methyl]carbamate.
| Compound Name | [4-[(2-amino-6-fluoro-3-pyridinyl)amino]-4-oxobutyl] N-[(3,5-dichlorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 130448052 |
| Molecular Formula | C17H17Cl2FN4O3 |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | [4-[(2-amino-6-fluoro-3-pyridinyl)amino]-4-oxobutyl] N-[(3,5-dichlorophenyl)methyl]carbamate |
| SMILES | Nc1nc(F)ccc1NC(=O)CCCOC(=O)NCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2FN4O3/c18-11-6-10(7-12(19)8-11)9-22-17(26)27-5-1-2-15(25)23-13-3-4-14(20)24-16(13)21/h3-4,6-8H,1-2,5,9H2,(H2,21,24)(H,22,26)(H,23,25) |
| InChIKey | KOSKINTYIBJQQR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|