C7H9ClN4O — CID 163544169
2-amino-N-(2-amino-6-chloro-3-pyridinyl)acetamide (PubChem CID 163544169) has the molecular formula C7H9ClN4O and a molecular weight of 200.63 g/mol. Its IUPAC name is 2-amino-N-(2-amino-6-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-amino-N-(2-amino-6-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 163544169 |
| Molecular Formula | C7H9ClN4O |
| Molecular Weight | 200.63 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 2-amino-N-(2-amino-6-chloro-3-pyridinyl)acetamide |
| SMILES | NCC(=O)Nc1ccc(Cl)nc1N |
| InChI | InChI=1S/C7H9ClN4O/c8-5-2-1-4(7(10)12-5)11-6(13)3-9/h1-2H,3,9H2,(H2,10,12)(H,11,13) |
| InChIKey | FDPKLHCSJUFBQM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.63 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|