C8H7Cl2N3O2 — CID 66548800
N'-(2,6-dichloro-3-pyridinyl)propanediamide (PubChem CID 66548800) has the molecular formula C8H7Cl2N3O2 and a molecular weight of 248.07 g/mol. Its IUPAC name is N'-(2,6-dichloro-3-pyridinyl)propanediamide.
| Compound Name | N'-(2,6-dichloro-3-pyridinyl)propanediamide |
|---|---|
| PubChem CID | 66548800 |
| Molecular Formula | C8H7Cl2N3O2 |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | N'-(2,6-dichloro-3-pyridinyl)propanediamide |
| SMILES | NC(=O)CC(=O)Nc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C8H7Cl2N3O2/c9-5-2-1-4(8(10)13-5)12-7(15)3-6(11)14/h1-2H,3H2,(H2,11,14)(H,12,15) |
| InChIKey | JMXFVRUCBSSANE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|