C14H19Cl2N3O3 — CID 66546122
N-(2,6-dichloro-3-pyridinyl)-N'-(2-methoxyethyl)-N'-propan-2-ylpropanediamide (PubChem CID 66546122) has the molecular formula C14H19Cl2N3O3 and a molecular weight of 348.23 g/mol. Its IUPAC name is N-(2,6-dichloro-3-pyridinyl)-N'-(2-methoxyethyl)-N'-propan-2-ylpropanediamide.
| Compound Name | N-(2,6-dichloro-3-pyridinyl)-N'-(2-methoxyethyl)-N'-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 66546122 |
| Molecular Formula | C14H19Cl2N3O3 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-(2,6-dichloro-3-pyridinyl)-N'-(2-methoxyethyl)-N'-propan-2-ylpropanediamide |
| SMILES | COCCN(C(=O)CC(=O)Nc1ccc(Cl)nc1Cl)C(C)C |
| InChI | InChI=1S/C14H19Cl2N3O3/c1-9(2)19(6-7-22-3)13(21)8-12(20)17-10-4-5-11(15)18-14(10)16/h4-5,9H,6-8H2,1-3H3,(H,17,20) |
| InChIKey | OLZQQEMHKFAHOV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|