C13H17Cl2N3O3 — CID 154492335
[(2R)-1-[(2,6-dichloro-3-pyridinyl)amino]-1-oxopropan-2-yl] N-tert-butylcarbamate (PubChem CID 154492335) has the molecular formula C13H17Cl2N3O3 and a molecular weight of 334.20 g/mol. Its IUPAC name is [(2R)-1-[(2,6-dichloro-3-pyridinyl)amino]-1-oxopropan-2-yl] N-tert-butylcarbamate.
| Compound Name | [(2R)-1-[(2,6-dichloro-3-pyridinyl)amino]-1-oxopropan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 154492335 |
| Molecular Formula | C13H17Cl2N3O3 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | [(2R)-1-[(2,6-dichloro-3-pyridinyl)amino]-1-oxopropan-2-yl] N-tert-butylcarbamate |
| SMILES | C[C@@H](OC(=O)NC(C)(C)C)C(=O)Nc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C13H17Cl2N3O3/c1-7(21-12(20)18-13(2,3)4)11(19)16-8-5-6-9(14)17-10(8)15/h5-7H,1-4H3,(H,16,19)(H,18,20)/t7-/m1/s1 |
| InChIKey | ATGDEBVDBLZOCB-SSDOTTSWSA-N |
| XLogP | 3.24 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|