C11H15Cl2N3O — CID 118608342
(2R)-2-[(2,6-dichloro-3-pyridinyl)amino]-N-propan-2-ylpropanamide (PubChem CID 118608342) has the molecular formula C11H15Cl2N3O and a molecular weight of 276.17 g/mol. Its IUPAC name is (2R)-2-[(2,6-dichloro-3-pyridinyl)amino]-N-propan-2-ylpropanamide.
| Compound Name | (2R)-2-[(2,6-dichloro-3-pyridinyl)amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 118608342 |
| Molecular Formula | C11H15Cl2N3O |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (2R)-2-[(2,6-dichloro-3-pyridinyl)amino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)[C@@H](C)Nc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C11H15Cl2N3O/c1-6(2)14-11(17)7(3)15-8-4-5-9(12)16-10(8)13/h4-7,15H,1-3H3,(H,14,17)/t7-/m1/s1 |
| InChIKey | TZAMPLYSSHSTEN-SSDOTTSWSA-N |
| XLogP | 2.71 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|