C11H13Cl2N3O3 — CID 66548806
N-(2,6-dichloro-3-pyridinyl)-N'-(2-hydroxyethyl)-N'-methylpropanediamide (PubChem CID 66548806) has the molecular formula C11H13Cl2N3O3 and a molecular weight of 306.15 g/mol. Its IUPAC name is N-(2,6-dichloro-3-pyridinyl)-N'-(2-hydroxyethyl)-N'-methylpropanediamide.
| Compound Name | N-(2,6-dichloro-3-pyridinyl)-N'-(2-hydroxyethyl)-N'-methylpropanediamide |
|---|---|
| PubChem CID | 66548806 |
| Molecular Formula | C11H13Cl2N3O3 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N-(2,6-dichloro-3-pyridinyl)-N'-(2-hydroxyethyl)-N'-methylpropanediamide |
| SMILES | CN(CCO)C(=O)CC(=O)Nc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C11H13Cl2N3O3/c1-16(4-5-17)10(19)6-9(18)14-7-2-3-8(12)15-11(7)13/h2-3,17H,4-6H2,1H3,(H,14,18) |
| InChIKey | RTNJVPVRLWKEPZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|