C12H13Cl4N3O2 — CID 66546303
N',N'-bis(2-chloroethyl)-N-(2,6-dichloro-3-pyridinyl)propanediamide (PubChem CID 66546303) has the molecular formula C12H13Cl4N3O2 and a molecular weight of 373.07 g/mol. Its IUPAC name is N',N'-bis(2-chloroethyl)-N-(2,6-dichloro-3-pyridinyl)propanediamide.
| Compound Name | N',N'-bis(2-chloroethyl)-N-(2,6-dichloro-3-pyridinyl)propanediamide |
|---|---|
| PubChem CID | 66546303 |
| Molecular Formula | C12H13Cl4N3O2 |
| Molecular Weight | 373.07 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | N',N'-bis(2-chloroethyl)-N-(2,6-dichloro-3-pyridinyl)propanediamide |
| SMILES | O=C(CC(=O)N(CCCl)CCCl)Nc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C12H13Cl4N3O2/c13-3-5-19(6-4-14)11(21)7-10(20)17-8-1-2-9(15)18-12(8)16/h1-2H,3-7H2,(H,17,20) |
| InChIKey | GVFUXLFGXHNVEN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.07 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|