C16H13Cl3N6O2 — CID 142507859
N-(2-amino-6-chloro-3-pyridinyl)-2-[4-[(2,4-dichlorophenyl)-hydroxymethyl]triazol-1-yl]acetamide (PubChem CID 142507859) has the molecular formula C16H13Cl3N6O2 and a molecular weight of 427.68 g/mol. Its IUPAC name is N-(2-amino-6-chloro-3-pyridinyl)-2-[4-[(2,4-dichlorophenyl)-hydroxymethyl]triazol-1-yl]acetamide.
| Compound Name | N-(2-amino-6-chloro-3-pyridinyl)-2-[4-[(2,4-dichlorophenyl)-hydroxymethyl]triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 142507859 |
| Molecular Formula | C16H13Cl3N6O2 |
| Molecular Weight | 427.68 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | N-(2-amino-6-chloro-3-pyridinyl)-2-[4-[(2,4-dichlorophenyl)-hydroxymethyl]triazol-1-yl]acetamide |
| SMILES | Nc1nc(Cl)ccc1NC(=O)Cn1cc(C(O)c2ccc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C16H13Cl3N6O2/c17-8-1-2-9(10(18)5-8)15(27)12-6-25(24-23-12)7-14(26)21-11-3-4-13(19)22-16(11)20/h1-6,15,27H,7H2,(H2,20,22)(H,21,26) |
| InChIKey | PCEVAYWZQXHWAP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.68 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|