C16H11Cl3N6O — CID 142507762
[1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]triazol-4-yl]-(2,4-dichlorophenyl)methanol (PubChem CID 142507762) has the molecular formula C16H11Cl3N6O and a molecular weight of 409.66 g/mol. Its IUPAC name is [1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]triazol-4-yl]-(2,4-dichlorophenyl)methanol.
| Compound Name | [1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]triazol-4-yl]-(2,4-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 142507762 |
| Molecular Formula | C16H11Cl3N6O |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | [1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]triazol-4-yl]-(2,4-dichlorophenyl)methanol |
| SMILES | OC(c1cn(Cc2nc3nc(Cl)ccc3[nH]2)nn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl3N6O/c17-8-1-2-9(10(18)5-8)15(26)12-6-25(24-23-12)7-14-20-11-3-4-13(19)21-16(11)22-14/h1-6,15,26H,7H2,(H,20,21,22) |
| InChIKey | UPNDGNHYQFAVIW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|