C15H11Cl3N4O — CID 130447855
N-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-2-(2,4-dichlorophenyl)acetamide (PubChem CID 130447855) has the molecular formula C15H11Cl3N4O and a molecular weight of 369.64 g/mol. Its IUPAC name is N-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-2-(2,4-dichlorophenyl)acetamide.
| Compound Name | N-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-2-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 130447855 |
| Molecular Formula | C15H11Cl3N4O |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | N-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-2-(2,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)NCc1nc2nc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C15H11Cl3N4O/c16-9-2-1-8(10(17)6-9)5-14(23)19-7-13-20-11-3-4-12(18)21-15(11)22-13/h1-4,6H,5,7H2,(H,19,23)(H,20,21,22) |
| InChIKey | ZBOHCHCLWLJISF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|