C11H10Cl2N4O — CID 54884808
2-(2,4-dichlorophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide (PubChem CID 54884808) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 54884808 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)NCc1ncn[nH]1 |
| InChI | InChI=1S/C11H10Cl2N4O/c12-8-2-1-7(9(13)4-8)3-11(18)14-5-10-15-6-16-17-10/h1-2,4,6H,3,5H2,(H,14,18)(H,15,16,17) |
| InChIKey | CIRBIWPJAZTFML-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |