C11H10ClN5O3 — CID 64524113
4-chloro-2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)benzoic acid (PubChem CID 64524113) has the molecular formula C11H10ClN5O3 and a molecular weight of 295.69 g/mol. Its IUPAC name is 4-chloro-2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 4-chloro-2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 64524113 |
| Molecular Formula | C11H10ClN5O3 |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 4-chloro-2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCc1ncn[nH]1)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C11H10ClN5O3/c12-6-1-2-7(10(18)19)8(3-6)16-11(20)13-4-9-14-5-15-17-9/h1-3,5H,4H2,(H,18,19)(H2,13,16,20)(H,14,15,17) |
| InChIKey | MEFBGHIAIYHTQM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |