C12H10ClN3O4S — CID 106382906
4-chloro-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]benzoic acid (PubChem CID 106382906) has the molecular formula C12H10ClN3O4S and a molecular weight of 327.75 g/mol. Its IUPAC name is 4-chloro-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]benzoic acid.
| Compound Name | 4-chloro-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 106382906 |
| Molecular Formula | C12H10ClN3O4S |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 4-chloro-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoylamino]benzoic acid |
| SMILES | O=C(NCc1csc(=O)[nH]1)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C12H10ClN3O4S/c13-6-1-2-8(10(17)18)9(3-6)16-11(19)14-4-7-5-21-12(20)15-7/h1-3,5H,4H2,(H,15,20)(H,17,18)(H2,14,16,19) |
| InChIKey | HGKBDSOUTGAYGC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |