C10H12N6O — CID 64531181
1-(4-aminophenyl)-3-(1H-1,2,4-triazol-5-ylmethyl)urea (PubChem CID 64531181) has the molecular formula C10H12N6O and a molecular weight of 232.25 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-(1H-1,2,4-triazol-5-ylmethyl)urea.
| Compound Name | 1-(4-aminophenyl)-3-(1H-1,2,4-triazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 64531181 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-(4-aminophenyl)-3-(1H-1,2,4-triazol-5-ylmethyl)urea |
| SMILES | Nc1ccc(NC(=O)NCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C10H12N6O/c11-7-1-3-8(4-2-7)15-10(17)12-5-9-13-6-14-16-9/h1-4,6H,5,11H2,(H2,12,15,17)(H,13,14,16) |
| InChIKey | HYYIPECCDAHFGX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|