C10H9F2N5O — CID 54880059
1-(2,4-difluorophenyl)-3-(1H-1,2,4-triazol-5-ylmethyl)urea (PubChem CID 54880059) has the molecular formula C10H9F2N5O and a molecular weight of 253.21 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(1H-1,2,4-triazol-5-ylmethyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(1H-1,2,4-triazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 54880059 |
| Molecular Formula | C10H9F2N5O |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(1H-1,2,4-triazol-5-ylmethyl)urea |
| SMILES | O=C(NCc1ncn[nH]1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C10H9F2N5O/c11-6-1-2-8(7(12)3-6)16-10(18)13-4-9-14-5-15-17-9/h1-3,5H,4H2,(H2,13,16,18)(H,14,15,17) |
| InChIKey | OJXLXPSUJSCQFW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |