C21H26Cl2FN5O2S — CID 118878817
tert-butyl N-[4-[(2-amino-6-fluoro-3-pyridinyl)carbamothioylamino]-1-(3,5-dichlorophenyl)butan-2-yl]carbamate (PubChem CID 118878817) has the molecular formula C21H26Cl2FN5O2S and a molecular weight of 502.44 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-amino-6-fluoro-3-pyridinyl)carbamothioylamino]-1-(3,5-dichlorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-amino-6-fluoro-3-pyridinyl)carbamothioylamino]-1-(3,5-dichlorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 118878817 |
| Molecular Formula | C21H26Cl2FN5O2S |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | tert-butyl N-[4-[(2-amino-6-fluoro-3-pyridinyl)carbamothioylamino]-1-(3,5-dichlorophenyl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCNC(=S)Nc1ccc(F)nc1N)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H26Cl2FN5O2S/c1-21(2,3)31-20(30)27-15(10-12-8-13(22)11-14(23)9-12)6-7-26-19(32)28-16-4-5-17(24)29-18(16)25/h4-5,8-9,11,15H,6-7,10H2,1-3H3,(H2,25,29)(H,27,30)(H2,26,28,32) |
| InChIKey | VGQVIYWIROHBCK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|