C11H10FeO4 — CID 11043549
carbon monoxide;1-cyclohexa-1,3-dien-1-ylethanone;iron (PubChem CID 11043549) has the molecular formula C11H10FeO4 and a molecular weight of 262.04 g/mol. Its IUPAC name is carbon monoxide;1-cyclohexa-1,3-dien-1-ylethanone;iron.
| Compound Name | carbon monoxide;1-cyclohexa-1,3-dien-1-ylethanone;iron |
|---|---|
| PubChem CID | 11043549 |
| Molecular Formula | C11H10FeO4 |
| Molecular Weight | 262.04 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | carbon monoxide;1-cyclohexa-1,3-dien-1-ylethanone;iron |
| SMILES | CC(=O)C1=CC=CCC1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C8H10O.3CO.Fe/c1-7(9)8-5-3-2-4-6-8;3*1-2;/h2-3,5H,4,6H2,1H3;;;; |
| InChIKey | DHSMMAILZSNATR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 76.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.04 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|