C11H14OS — CID 15369277
S-[(E)-but-2-enyl] cyclohexa-1,3-diene-1-carbothioate (PubChem CID 15369277) has the molecular formula C11H14OS and a molecular weight of 194.30 g/mol. Its IUPAC name is S-[(E)-but-2-enyl] cyclohexa-1,3-diene-1-carbothioate.
| Compound Name | S-[(E)-but-2-enyl] cyclohexa-1,3-diene-1-carbothioate |
|---|---|
| PubChem CID | 15369277 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | S-[(E)-but-2-enyl] cyclohexa-1,3-diene-1-carbothioate |
| SMILES | C/C=C/CSC(=O)C1=CC=CCC1 |
| InChI | InChI=1S/C11H14OS/c1-2-3-9-13-11(12)10-7-5-4-6-8-10/h2-5,7H,6,8-9H2,1H3/b3-2+ |
| InChIKey | IUFYLBWGFJNHLF-NSCUHMNNSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|